C35H43BrO5 — CID 121309047
ethyl 8-bromo-6-[4-(hydroxymethyl)phenyl]-2,2-dimethyl-8-[4-(oxiran-2-ylmethoxymethyl)phenyl]-4-phenyloctanoate (PubChem CID 121309047) has the molecular formula C35H43BrO5 and a molecular weight of 623.63 g/mol. Its IUPAC name is ethyl 8-bromo-6-[4-(hydroxymethyl)phenyl]-2,2-dimethyl-8-[4-(oxiran-2-ylmethoxymethyl)phenyl]-4-phenyloctanoate.
| Compound Name | ethyl 8-bromo-6-[4-(hydroxymethyl)phenyl]-2,2-dimethyl-8-[4-(oxiran-2-ylmethoxymethyl)phenyl]-4-phenyloctanoate |
|---|---|
| PubChem CID | 121309047 |
| Molecular Formula | C35H43BrO5 |
| Molecular Weight | 623.63 g/mol |
| Exact Mass | 622.23 |
| IUPAC Name | ethyl 8-bromo-6-[4-(hydroxymethyl)phenyl]-2,2-dimethyl-8-[4-(oxiran-2-ylmethoxymethyl)phenyl]-4-phenyloctanoate |
| SMILES | CCOC(=O)C(C)(C)CC(CC(CC(Br)c1ccc(COCC2CO2)cc1)c1ccc(CO)cc1)c1ccccc1 |
| InChI | InChI=1S/C35H43BrO5/c1-4-40-34(38)35(2,3)20-31(27-8-6-5-7-9-27)18-30(28-14-10-25(21-37)11-15-28)19-33(36)29-16-12-26(13-17-29)22-39-23-32-24-41-32/h5-17,30-33,37H,4,18-24H2,1-3H3 |
| InChIKey | BFDBVMICTYYBFW-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.63 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|