C40H75N2O5S3+ — CID 171508546
2-[3-[2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoyl]oxypropyl-(3-sulfinopropyl)amino]ethyl-(3-hydroxysulfanylpropyl)-dimethylazanium (PubChem CID 171508546) has the molecular formula C40H75N2O5S3+ and a molecular weight of 760.25 g/mol. Its IUPAC name is 2-[3-[2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoyl]oxypropyl-(3-sulfinopropyl)amino]ethyl-(3-hydroxysulfanylpropyl)-dimethylazanium.
| Compound Name | 2-[3-[2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoyl]oxypropyl-(3-sulfinopropyl)amino]ethyl-(3-hydroxysulfanylpropyl)-dimethylazanium |
|---|---|
| PubChem CID | 171508546 |
| Molecular Formula | C40H75N2O5S3+ |
| Molecular Weight | 760.25 g/mol |
| Exact Mass | 759.48 |
| IUPAC Name | 2-[3-[2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoyl]oxypropyl-(3-sulfinopropyl)amino]ethyl-(3-hydroxysulfanylpropyl)-dimethylazanium |
| SMILES | CC(C)(C)CC(c1ccc(CS)cc1)C(C)(C)C(C)(C)CC(C)(C(=O)OCCCN(CCCS(=O)O)CC[N+](C)(C)CCCSO)C(C)(C)C |
| InChI | InChI=1S/C40H74N2O5S3/c1-36(2,3)29-34(33-19-17-32(30-48)18-20-33)39(9,10)38(7,8)31-40(11,37(4,5)6)35(43)47-26-14-21-41(22-15-28-50(45)46)23-25-42(12,13)24-16-27-49-44/h17-20,34H,14-16,21-31H2,1-13H3,(H2-,44,45,46,48)/p+1 |
| InChIKey | GRFFZNOUMDMHLG-UHFFFAOYSA-O |
| XLogP | 9.65 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.25 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|