C34H62N2OS — CID 171508500
6-tert-butyl-1-[2-(dimethylamino)ethylamino]-6,7,7,8,8,11,11-heptamethyl-9-[4-(sulfanylmethyl)phenyl]dodecan-5-one (PubChem CID 171508500) has the molecular formula C34H62N2OS and a molecular weight of 546.95 g/mol. Its IUPAC name is 6-tert-butyl-1-[2-(dimethylamino)ethylamino]-6,7,7,8,8,11,11-heptamethyl-9-[4-(sulfanylmethyl)phenyl]dodecan-5-one.
| Compound Name | 6-tert-butyl-1-[2-(dimethylamino)ethylamino]-6,7,7,8,8,11,11-heptamethyl-9-[4-(sulfanylmethyl)phenyl]dodecan-5-one |
|---|---|
| PubChem CID | 171508500 |
| Molecular Formula | C34H62N2OS |
| Molecular Weight | 546.95 g/mol |
| Exact Mass | 546.46 |
| IUPAC Name | 6-tert-butyl-1-[2-(dimethylamino)ethylamino]-6,7,7,8,8,11,11-heptamethyl-9-[4-(sulfanylmethyl)phenyl]dodecan-5-one |
| SMILES | CN(C)CCNCCCCC(=O)C(C)(C(C)(C)C)C(C)(C)C(C)(C)C(CC(C)(C)C)c1ccc(CS)cc1 |
| InChI | InChI=1S/C34H62N2OS/c1-30(2,3)24-28(27-19-17-26(25-38)18-20-27)32(7,8)33(9,10)34(11,31(4,5)6)29(37)16-14-15-21-35-22-23-36(12)13/h17-20,28,35,38H,14-16,21-25H2,1-13H3 |
| InChIKey | XOXDBPLGJVBWKQ-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.95 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|