C27H45BrO3 — CID 89249779
methyl 2-(bromomethyl)-2-tert-butyl-6-(4-hydroxyphenyl)-4,4,5,5,8,8-hexamethylnonanoate (PubChem CID 89249779) has the molecular formula C27H45BrO3 and a molecular weight of 497.56 g/mol. Its IUPAC name is methyl 2-(bromomethyl)-2-tert-butyl-6-(4-hydroxyphenyl)-4,4,5,5,8,8-hexamethylnonanoate.
| Compound Name | methyl 2-(bromomethyl)-2-tert-butyl-6-(4-hydroxyphenyl)-4,4,5,5,8,8-hexamethylnonanoate |
|---|---|
| PubChem CID | 89249779 |
| Molecular Formula | C27H45BrO3 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | methyl 2-(bromomethyl)-2-tert-butyl-6-(4-hydroxyphenyl)-4,4,5,5,8,8-hexamethylnonanoate |
| SMILES | COC(=O)C(CBr)(CC(C)(C)C(C)(C)C(CC(C)(C)C)c1ccc(O)cc1)C(C)(C)C |
| InChI | InChI=1S/C27H45BrO3/c1-23(2,3)16-21(19-12-14-20(29)15-13-19)26(9,10)25(7,8)17-27(18-28,22(30)31-11)24(4,5)6/h12-15,21,29H,16-18H2,1-11H3 |
| InChIKey | HLIIITXUPSXCKR-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|