C35H62O4 — CID 123657460
(3,3-dimethyl-1-propan-2-yloxybutyl) 2-ethyl-8-(4-hydroxyphenyl)-2,4,4,7,7,10,10-heptamethylundecanoate (PubChem CID 123657460) has the molecular formula C35H62O4 and a molecular weight of 546.88 g/mol. Its IUPAC name is (3,3-dimethyl-1-propan-2-yloxybutyl) 2-ethyl-8-(4-hydroxyphenyl)-2,4,4,7,7,10,10-heptamethylundecanoate.
| Compound Name | (3,3-dimethyl-1-propan-2-yloxybutyl) 2-ethyl-8-(4-hydroxyphenyl)-2,4,4,7,7,10,10-heptamethylundecanoate |
|---|---|
| PubChem CID | 123657460 |
| Molecular Formula | C35H62O4 |
| Molecular Weight | 546.88 g/mol |
| Exact Mass | 546.46 |
| IUPAC Name | (3,3-dimethyl-1-propan-2-yloxybutyl) 2-ethyl-8-(4-hydroxyphenyl)-2,4,4,7,7,10,10-heptamethylundecanoate |
| SMILES | CCC(C)(CC(C)(C)CCC(C)(C)C(CC(C)(C)C)c1ccc(O)cc1)C(=O)OC(CC(C)(C)C)OC(C)C |
| InChI | InChI=1S/C35H62O4/c1-15-35(14,30(37)39-29(38-25(2)3)23-32(7,8)9)24-33(10,11)20-21-34(12,13)28(22-31(4,5)6)26-16-18-27(36)19-17-26/h16-19,25,28-29,36H,15,20-24H2,1-14H3 |
| InChIKey | SQTBPRSUZVAPED-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.88 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|