C14H28O3 — CID 90336510
(3,3-dimethyl-1-propan-2-yloxybutyl) 2-methylbutanoate (PubChem CID 90336510) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is (3,3-dimethyl-1-propan-2-yloxybutyl) 2-methylbutanoate.
| Compound Name | (3,3-dimethyl-1-propan-2-yloxybutyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 90336510 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | (3,3-dimethyl-1-propan-2-yloxybutyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC(CC(C)(C)C)OC(C)C |
| InChI | InChI=1S/C14H28O3/c1-8-11(4)13(15)17-12(16-10(2)3)9-14(5,6)7/h10-12H,8-9H2,1-7H3 |
| InChIKey | GHYYCDHWQXKQGO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|