C22H37NO3 — CID 174314090
N,N-bis(2-hydroxyethyl)-4-(2,2,5,5-tetramethylheptan-4-yl)benzamide (PubChem CID 174314090) has the molecular formula C22H37NO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-4-(2,2,5,5-tetramethylheptan-4-yl)benzamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-4-(2,2,5,5-tetramethylheptan-4-yl)benzamide |
|---|---|
| PubChem CID | 174314090 |
| Molecular Formula | C22H37NO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.28 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-4-(2,2,5,5-tetramethylheptan-4-yl)benzamide |
| SMILES | CCC(C)(C)C(CC(C)(C)C)c1ccc(C(=O)N(CCO)CCO)cc1 |
| InChI | InChI=1S/C22H37NO3/c1-7-22(5,6)19(16-21(2,3)4)17-8-10-18(11-9-17)20(26)23(12-14-24)13-15-25/h8-11,19,24-25H,7,12-16H2,1-6H3 |
| InChIKey | CPKQWUGDRMWLDS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |