C34H62N2O2S — CID 171508495
3-[2-(dimethylamino)ethylamino]propyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoate (PubChem CID 171508495) has the molecular formula C34H62N2O2S and a molecular weight of 562.95 g/mol. Its IUPAC name is 3-[2-(dimethylamino)ethylamino]propyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoate.
| Compound Name | 3-[2-(dimethylamino)ethylamino]propyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoate |
|---|---|
| PubChem CID | 171508495 |
| Molecular Formula | C34H62N2O2S |
| Molecular Weight | 562.95 g/mol |
| Exact Mass | 562.45 |
| IUPAC Name | 3-[2-(dimethylamino)ethylamino]propyl 2-tert-butyl-2,4,4,5,5,8,8-heptamethyl-6-[4-(sulfanylmethyl)phenyl]nonanoate |
| SMILES | CN(C)CCNCCCOC(=O)C(C)(CC(C)(C)C(C)(C)C(CC(C)(C)C)c1ccc(CS)cc1)C(C)(C)C |
| InChI | InChI=1S/C34H62N2O2S/c1-30(2,3)23-28(27-17-15-26(24-39)16-18-27)33(9,10)32(7,8)25-34(11,31(4,5)6)29(37)38-22-14-19-35-20-21-36(12)13/h15-18,28,35,39H,14,19-25H2,1-13H3 |
| InChIKey | GDRJVSKXXOLACR-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.95 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|