C36H64FN3O4 — CID 171508504
1-O-[3-(2-aminoethylamino)propyl] 6-O-[3-[(2-fluorophenyl)methylamino]propyl] 5-tert-butyl-2-(2,2-dimethylpropyl)-2,3,3,4,4,5-hexamethylhexanedioate (PubChem CID 171508504) has the molecular formula C36H64FN3O4 and a molecular weight of 621.92 g/mol. Its IUPAC name is 1-O-[3-(2-aminoethylamino)propyl] 6-O-[3-[(2-fluorophenyl)methylamino]propyl] 5-tert-butyl-2-(2,2-dimethylpropyl)-2,3,3,4,4,5-hexamethylhexanedioate.
| Compound Name | 1-O-[3-(2-aminoethylamino)propyl] 6-O-[3-[(2-fluorophenyl)methylamino]propyl] 5-tert-butyl-2-(2,2-dimethylpropyl)-2,3,3,4,4,5-hexamethylhexanedioate |
|---|---|
| PubChem CID | 171508504 |
| Molecular Formula | C36H64FN3O4 |
| Molecular Weight | 621.92 g/mol |
| Exact Mass | 621.49 |
| IUPAC Name | 1-O-[3-(2-aminoethylamino)propyl] 6-O-[3-[(2-fluorophenyl)methylamino]propyl] 5-tert-butyl-2-(2,2-dimethylpropyl)-2,3,3,4,4,5-hexamethylhexanedioate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCCNCCN)C(C)(C)C(C)(C)C(C)(C(=O)OCCCNCc1ccccc1F)C(C)(C)C |
| InChI | InChI=1S/C36H64FN3O4/c1-31(2,3)26-35(11,29(41)43-23-15-20-39-22-19-38)33(7,8)34(9,10)36(12,32(4,5)6)30(42)44-24-16-21-40-25-27-17-13-14-18-28(27)37/h13-14,17-18,39-40H,15-16,19-26,38H2,1-12H3 |
| InChIKey | XHNQHXCOLAPRKY-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.92 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|