C35H56N2O2S — CID 171508608
3-(pyridin-2-ylmethylamino)propyl 2-tert-butyl-2,3,3,4,4,7,7-heptamethyl-5-[4-(sulfanylmethyl)phenyl]octanoate (PubChem CID 171508608) has the molecular formula C35H56N2O2S and a molecular weight of 568.91 g/mol. Its IUPAC name is 3-(pyridin-2-ylmethylamino)propyl 2-tert-butyl-2,3,3,4,4,7,7-heptamethyl-5-[4-(sulfanylmethyl)phenyl]octanoate.
| Compound Name | 3-(pyridin-2-ylmethylamino)propyl 2-tert-butyl-2,3,3,4,4,7,7-heptamethyl-5-[4-(sulfanylmethyl)phenyl]octanoate |
|---|---|
| PubChem CID | 171508608 |
| Molecular Formula | C35H56N2O2S |
| Molecular Weight | 568.91 g/mol |
| Exact Mass | 568.41 |
| IUPAC Name | 3-(pyridin-2-ylmethylamino)propyl 2-tert-butyl-2,3,3,4,4,7,7-heptamethyl-5-[4-(sulfanylmethyl)phenyl]octanoate |
| SMILES | CC(C)(C)CC(c1ccc(CS)cc1)C(C)(C)C(C)(C)C(C)(C(=O)OCCCNCc1ccccn1)C(C)(C)C |
| InChI | InChI=1S/C35H56N2O2S/c1-31(2,3)23-29(27-18-16-26(25-40)17-19-27)33(7,8)34(9,10)35(11,32(4,5)6)30(38)39-22-14-20-36-24-28-15-12-13-21-37-28/h12-13,15-19,21,29,36,40H,14,20,22-25H2,1-11H3 |
| InChIKey | KZKHTAKGFSGFPG-UHFFFAOYSA-N |
| XLogP | 8.86 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.91 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|