C29H50O2S — CID 144527031
2-ethylsulfanylethyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-phenylnonanoate (PubChem CID 144527031) has the molecular formula C29H50O2S and a molecular weight of 462.78 g/mol. Its IUPAC name is 2-ethylsulfanylethyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-phenylnonanoate.
| Compound Name | 2-ethylsulfanylethyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-phenylnonanoate |
|---|---|
| PubChem CID | 144527031 |
| Molecular Formula | C29H50O2S |
| Molecular Weight | 462.78 g/mol |
| Exact Mass | 462.35 |
| IUPAC Name | 2-ethylsulfanylethyl 2-tert-butyl-4,4,5,5,8,8-hexamethyl-6-phenylnonanoate |
| SMILES | CCSCCOC(=O)C(CC(C)(C)C(C)(C)C(CC(C)(C)C)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H50O2S/c1-12-32-19-18-31-25(30)24(27(5,6)7)21-28(8,9)29(10,11)23(20-26(2,3)4)22-16-14-13-15-17-22/h13-17,23-24H,12,18-21H2,1-11H3 |
| InChIKey | BRRCVQWURYTRJP-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.78 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|