C15H21ClOS — CID 88671945
S-ethyl 5-chloro-3,3-dimethyl-5-phenylpentanethioate (PubChem CID 88671945) has the molecular formula C15H21ClOS and a molecular weight of 284.85 g/mol. Its IUPAC name is S-ethyl 5-chloro-3,3-dimethyl-5-phenylpentanethioate.
| Compound Name | S-ethyl 5-chloro-3,3-dimethyl-5-phenylpentanethioate |
|---|---|
| PubChem CID | 88671945 |
| Molecular Formula | C15H21ClOS |
| Molecular Weight | 284.85 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | S-ethyl 5-chloro-3,3-dimethyl-5-phenylpentanethioate |
| SMILES | CCSC(=O)CC(C)(C)CC(Cl)c1ccccc1 |
| InChI | InChI=1S/C15H21ClOS/c1-4-18-14(17)11-15(2,3)10-13(16)12-8-6-5-7-9-12/h5-9,13H,4,10-11H2,1-3H3 |
| InChIKey | IBLNFOAKGPMKIL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.85 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|