C23H39OP — CID 143183672
[(Z)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]hex-3-enyl]phosphane (PubChem CID 143183672) has the molecular formula C23H39OP and a molecular weight of 362.54 g/mol. Its IUPAC name is [(Z)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]hex-3-enyl]phosphane.
| Compound Name | [(Z)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]hex-3-enyl]phosphane |
|---|---|
| PubChem CID | 143183672 |
| Molecular Formula | C23H39OP |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | [(Z)-3-[[4-(2,2,5,5-tetramethylhexan-3-yl)phenyl]methoxy]hex-3-enyl]phosphane |
| SMILES | CC/C=C(/CCP)OCc1ccc(C(CC(C)(C)C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H39OP/c1-8-9-20(14-15-25)24-17-18-10-12-19(13-11-18)21(23(5,6)7)16-22(2,3)4/h9-13,21H,8,14-17,25H2,1-7H3/b20-9- |
| InChIKey | AYTHWIUBSNYMPT-UKWGHVSLSA-N |
| XLogP | 7.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|