C17H29OP — CID 134293506
[4,4-dimethyl-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phosphane (PubChem CID 134293506) has the molecular formula C17H29OP and a molecular weight of 280.39 g/mol. Its IUPAC name is [4,4-dimethyl-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phosphane.
| Compound Name | [4,4-dimethyl-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phosphane |
|---|---|
| PubChem CID | 134293506 |
| Molecular Formula | C17H29OP |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [4,4-dimethyl-2-[4-[(2-methylpropan-2-yl)oxy]phenyl]pentyl]phosphane |
| SMILES | CC(C)(C)CC(CP)c1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C17H29OP/c1-16(2,3)11-14(12-19)13-7-9-15(10-8-13)18-17(4,5)6/h7-10,14H,11-12,19H2,1-6H3 |
| InChIKey | ZYTBYBLQCXOBLB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|