C18H31OP — CID 155135729
2-[4-(4,4-dimethyl-1-phosphanylpentan-2-yl)phenyl]pentan-2-ol (PubChem CID 155135729) has the molecular formula C18H31OP and a molecular weight of 294.42 g/mol. Its IUPAC name is 2-[4-(4,4-dimethyl-1-phosphanylpentan-2-yl)phenyl]pentan-2-ol.
| Compound Name | 2-[4-(4,4-dimethyl-1-phosphanylpentan-2-yl)phenyl]pentan-2-ol |
|---|---|
| PubChem CID | 155135729 |
| Molecular Formula | C18H31OP |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-[4-(4,4-dimethyl-1-phosphanylpentan-2-yl)phenyl]pentan-2-ol |
| SMILES | CCCC(C)(O)c1ccc(C(CP)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H31OP/c1-6-11-18(5,19)16-9-7-14(8-10-16)15(13-20)12-17(2,3)4/h7-10,15,19H,6,11-13,20H2,1-5H3 |
| InChIKey | FCBLDXVXBSREMV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|