C20H28F6O — CID 123480330
1,1,1,3,3,3-hexafluoro-2-[4-(2,2,6,6-tetramethylheptan-4-yl)phenyl]propan-2-ol (PubChem CID 123480330) has the molecular formula C20H28F6O and a molecular weight of 398.43 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-(2,2,6,6-tetramethylheptan-4-yl)phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-(2,2,6,6-tetramethylheptan-4-yl)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 123480330 |
| Molecular Formula | C20H28F6O |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-(2,2,6,6-tetramethylheptan-4-yl)phenyl]propan-2-ol |
| SMILES | CC(C)(C)CC(CC(C)(C)C)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H28F6O/c1-16(2,3)11-14(12-17(4,5)6)13-7-9-15(10-8-13)18(27,19(21,22)23)20(24,25)26/h7-10,14,27H,11-12H2,1-6H3 |
| InChIKey | BUBYIRCBHMGQRY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |