C23H20F12O2 — CID 118531960
1,1,1,3,3,3-hexafluoro-2-[4-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pentyl]phenyl]propan-2-ol (PubChem CID 118531960) has the molecular formula C23H20F12O2 and a molecular weight of 556.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pentyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pentyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 118531960 |
| Molecular Formula | C23H20F12O2 |
| Molecular Weight | 556.39 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]pentyl]phenyl]propan-2-ol |
| SMILES | CCC(CCc1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H20F12O2/c1-2-14(15-7-11-17(12-8-15)19(37,22(30,31)32)23(33,34)35)6-3-13-4-9-16(10-5-13)18(36,20(24,25)26)21(27,28)29/h4-5,7-12,14,36-37H,2-3,6H2,1H3 |
| InChIKey | GFJBZSRHBBKPHJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.39 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |