About 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium
1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium (PubChem CID 178166385) has the molecular formula C17H30Y
and a molecular weight of 323.33 g/mol. Its IUPAC name is 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium.
Molecular Properties
| Compound Name | 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium |
| PubChem CID | 178166385 |
| Molecular Formula | C17H30Y |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium |
| SMILES | CC.CCC(CC)c1ccc(C(C)(C)C)cc1.[Y] |
| InChI | InChI=1S/C15H24.C2H6.Y/c1-6-12(7-2)13-8-10-14(11-9-13)15(3,4)5;1-2;/h8-12H,6-7H2,1-5H3;1-2H3; |
| InChIKey | ZKHLEYWEJYLJKL-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium?
The IUPAC name of 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium (CID 178166385) is 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium.
What is the SMILES notation for 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium?
The canonical SMILES for 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium is CC.CCC(CC)c1ccc(C(C)(C)C)cc1.[Y].
What is the InChIKey of 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium?
The InChIKey is ZKHLEYWEJYLJKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24.C2H6.Y/c1-6-12(7-2)13-8-10-14(11-9-13)15(3,4)5;1-2;/h8-12H,6-7H2,1-5H3;1-2H3;.
What are the key properties of 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium?
1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium has a molecular weight of 323.33 g/mol, XLogP of 5.91, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-pentan-3-ylbenzene;ethane;yttrium is sourced from PubChem (CID 178166385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).