C30H35FO — CID 143696076
1-(4-tert-butylphenyl)-2-(4-fluorophenyl)-3-(4-pentan-3-ylphenyl)propan-1-one (PubChem CID 143696076) has the molecular formula C30H35FO and a molecular weight of 430.61 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-2-(4-fluorophenyl)-3-(4-pentan-3-ylphenyl)propan-1-one.
| Compound Name | 1-(4-tert-butylphenyl)-2-(4-fluorophenyl)-3-(4-pentan-3-ylphenyl)propan-1-one |
|---|---|
| PubChem CID | 143696076 |
| Molecular Formula | C30H35FO |
| Molecular Weight | 430.61 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | 1-(4-tert-butylphenyl)-2-(4-fluorophenyl)-3-(4-pentan-3-ylphenyl)propan-1-one |
| SMILES | CCC(CC)c1ccc(CC(C(=O)c2ccc(C(C)(C)C)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C30H35FO/c1-6-22(7-2)23-10-8-21(9-11-23)20-28(24-14-18-27(31)19-15-24)29(32)25-12-16-26(17-13-25)30(3,4)5/h8-19,22,28H,6-7,20H2,1-5H3 |
| InChIKey | FWXZJNKENLMRQJ-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.61 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |