C19H22FNO — CID 68577173
3-(4-tert-butylphenyl)-2-(4-fluorophenyl)propanamide (PubChem CID 68577173) has the molecular formula C19H22FNO and a molecular weight of 299.39 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-(4-fluorophenyl)propanamide.
| Compound Name | 3-(4-tert-butylphenyl)-2-(4-fluorophenyl)propanamide |
|---|---|
| PubChem CID | 68577173 |
| Molecular Formula | C19H22FNO |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-(4-fluorophenyl)propanamide |
| SMILES | CC(C)(C)c1ccc(CC(C(N)=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C19H22FNO/c1-19(2,3)15-8-4-13(5-9-15)12-17(18(21)22)14-6-10-16(20)11-7-14/h4-11,17H,12H2,1-3H3,(H2,21,22) |
| InChIKey | OQDMDHBYLVDDNC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |