C20H25NO — CID 129383585
(2R)-2-(4-tert-butylphenyl)-4-phenylbutanamide (PubChem CID 129383585) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is (2R)-2-(4-tert-butylphenyl)-4-phenylbutanamide.
| Compound Name | (2R)-2-(4-tert-butylphenyl)-4-phenylbutanamide |
|---|---|
| PubChem CID | 129383585 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | (2R)-2-(4-tert-butylphenyl)-4-phenylbutanamide |
| SMILES | CC(C)(C)c1ccc([C@@H](CCc2ccccc2)C(N)=O)cc1 |
| InChI | InChI=1S/C20H25NO/c1-20(2,3)17-12-10-16(11-13-17)18(19(21)22)14-9-15-7-5-4-6-8-15/h4-8,10-13,18H,9,14H2,1-3H3,(H2,21,22)/t18-/m1/s1 |
| InChIKey | ZDPSCXIXWCHVLY-GOSISDBHSA-N |
| XLogP | 4.19 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |