C20H23BrO — CID 13458706
4-(4-bromophenyl)-2,2-dimethyl-6-phenylhexan-3-one (PubChem CID 13458706) has the molecular formula C20H23BrO and a molecular weight of 359.31 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,2-dimethyl-6-phenylhexan-3-one.
| Compound Name | 4-(4-bromophenyl)-2,2-dimethyl-6-phenylhexan-3-one |
|---|---|
| PubChem CID | 13458706 |
| Molecular Formula | C20H23BrO |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 4-(4-bromophenyl)-2,2-dimethyl-6-phenylhexan-3-one |
| SMILES | CC(C)(C)C(=O)C(CCc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H23BrO/c1-20(2,3)19(22)18(16-10-12-17(21)13-11-16)14-9-15-7-5-4-6-8-15/h4-8,10-13,18H,9,14H2,1-3H3 |
| InChIKey | VIWGMDLRKQBMQS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |