C15H21BrO — CID 13371234
4-bromo-2,2-dimethyl-7-phenylheptan-3-one (PubChem CID 13371234) has the molecular formula C15H21BrO and a molecular weight of 297.24 g/mol. Its IUPAC name is 4-bromo-2,2-dimethyl-7-phenylheptan-3-one.
| Compound Name | 4-bromo-2,2-dimethyl-7-phenylheptan-3-one |
|---|---|
| PubChem CID | 13371234 |
| Molecular Formula | C15H21BrO |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 4-bromo-2,2-dimethyl-7-phenylheptan-3-one |
| SMILES | CC(C)(C)C(=O)C(Br)CCCc1ccccc1 |
| InChI | InChI=1S/C15H21BrO/c1-15(2,3)14(17)13(16)11-7-10-12-8-5-4-6-9-12/h4-6,8-9,13H,7,10-11H2,1-3H3 |
| InChIKey | MTQPRAZZIDYISC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|