About 2-bromo-5-phenylpentanal
2-bromo-5-phenylpentanal (PubChem CID 121216418) has the molecular formula C11H13BrO
and a molecular weight of 241.13 g/mol. Its IUPAC name is 2-bromo-5-phenylpentanal.
Molecular Properties
| Compound Name | 2-bromo-5-phenylpentanal |
| PubChem CID | 121216418 |
| Molecular Formula | C11H13BrO |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.01 |
| IUPAC Name | 2-bromo-5-phenylpentanal |
| SMILES | O=CC(Br)CCCc1ccccc1 |
| InChI | InChI=1S/C11H13BrO/c12-11(9-13)8-4-7-10-5-2-1-3-6-10/h1-3,5-6,9,11H,4,7-8H2 |
| InChIKey | KUNZNFPVGUMNLV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-5-phenylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-phenylpentanal?
The IUPAC name of 2-bromo-5-phenylpentanal (CID 121216418) is 2-bromo-5-phenylpentanal.
What is the SMILES notation for 2-bromo-5-phenylpentanal?
The canonical SMILES for 2-bromo-5-phenylpentanal is O=CC(Br)CCCc1ccccc1.
What is the InChIKey of 2-bromo-5-phenylpentanal?
The InChIKey is KUNZNFPVGUMNLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrO/c12-11(9-13)8-4-7-10-5-2-1-3-6-10/h1-3,5-6,9,11H,4,7-8H2.
What are the key properties of 2-bromo-5-phenylpentanal?
2-bromo-5-phenylpentanal has a molecular weight of 241.13 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-phenylpentanal is sourced from PubChem (CID 121216418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).