C13H14BrF3 — CID 90344339
[(E)-4-bromo-7,7,7-trifluorohept-5-enyl]benzene (PubChem CID 90344339) has the molecular formula C13H14BrF3 and a molecular weight of 307.15 g/mol. Its IUPAC name is [(E)-4-bromo-7,7,7-trifluorohept-5-enyl]benzene.
| Compound Name | [(E)-4-bromo-7,7,7-trifluorohept-5-enyl]benzene |
|---|---|
| PubChem CID | 90344339 |
| Molecular Formula | C13H14BrF3 |
| Molecular Weight | 307.15 g/mol |
| Exact Mass | 306.02 |
| IUPAC Name | [(E)-4-bromo-7,7,7-trifluorohept-5-enyl]benzene |
| SMILES | FC(F)(F)/C=C/C(Br)CCCc1ccccc1 |
| InChI | InChI=1S/C13H14BrF3/c14-12(9-10-13(15,16)17)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9-10,12H,4,7-8H2/b10-9+ |
| InChIKey | XTLKWINMSSEERS-MDZDMXLPSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.15 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|