C13H15F3O2 — CID 10491564
(E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-ol (PubChem CID 10491564) has the molecular formula C13H15F3O2 and a molecular weight of 260.25 g/mol. Its IUPAC name is (E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-ol.
| Compound Name | (E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-ol |
|---|---|
| PubChem CID | 10491564 |
| Molecular Formula | C13H15F3O2 |
| Molecular Weight | 260.25 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | (E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-ol |
| SMILES | OC(/C=C/C(F)(F)F)CCOCc1ccccc1 |
| InChI | InChI=1S/C13H15F3O2/c14-13(15,16)8-6-12(17)7-9-18-10-11-4-2-1-3-5-11/h1-6,8,12,17H,7,9-10H2/b8-6+ |
| InChIKey | DVLMWYOTQNUZRR-SOFGYWHQSA-N |
| XLogP | 3.07 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|