C15H16ClF3O3 — CID 10568904
2-[(E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-yl]oxyacetyl chloride (PubChem CID 10568904) has the molecular formula C15H16ClF3O3 and a molecular weight of 336.74 g/mol. Its IUPAC name is 2-[(E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-yl]oxyacetyl chloride.
| Compound Name | 2-[(E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-yl]oxyacetyl chloride |
|---|---|
| PubChem CID | 10568904 |
| Molecular Formula | C15H16ClF3O3 |
| Molecular Weight | 336.74 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[(E)-6,6,6-trifluoro-1-phenylmethoxyhex-4-en-3-yl]oxyacetyl chloride |
| SMILES | O=C(Cl)COC(/C=C/C(F)(F)F)CCOCc1ccccc1 |
| InChI | InChI=1S/C15H16ClF3O3/c16-14(20)11-22-13(6-8-15(17,18)19)7-9-21-10-12-4-2-1-3-5-12/h1-6,8,13H,7,9-11H2/b8-6+ |
| InChIKey | JWRZSRQRTXTBRJ-SOFGYWHQSA-N |
| XLogP | 3.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.74 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|