C14H19BrO — CID 13458704
4-(4-bromophenyl)-2,2-dimethylhexan-3-one (PubChem CID 13458704) has the molecular formula C14H19BrO and a molecular weight of 283.21 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,2-dimethylhexan-3-one.
| Compound Name | 4-(4-bromophenyl)-2,2-dimethylhexan-3-one |
|---|---|
| PubChem CID | 13458704 |
| Molecular Formula | C14H19BrO |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-(4-bromophenyl)-2,2-dimethylhexan-3-one |
| SMILES | CCC(C(=O)C(C)(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H19BrO/c1-5-12(13(16)14(2,3)4)10-6-8-11(15)9-7-10/h6-9,12H,5H2,1-4H3 |
| InChIKey | PKEHKVPFDZVGDJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |