C20H28OSi — CID 173016744
2,2-dimethylhexan-3-yloxy(diphenyl)silane (PubChem CID 173016744) has the molecular formula C20H28OSi and a molecular weight of 312.53 g/mol. Its IUPAC name is 2,2-dimethylhexan-3-yloxy(diphenyl)silane.
| Compound Name | 2,2-dimethylhexan-3-yloxy(diphenyl)silane |
|---|---|
| PubChem CID | 173016744 |
| Molecular Formula | C20H28OSi |
| Molecular Weight | 312.53 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 2,2-dimethylhexan-3-yloxy(diphenyl)silane |
| SMILES | CCCC(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C20H28OSi/c1-5-12-19(20(2,3)4)21-22(17-13-8-6-9-14-17)18-15-10-7-11-16-18/h6-11,13-16,19,22H,5,12H2,1-4H3 |
| InChIKey | HZFWNPRWXHXNIA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|