C22H30O3Si — CID 173316919
6-diphenylsilyloxy-7,7-dimethyloct-1-ene-4,5-diol (PubChem CID 173316919) has the molecular formula C22H30O3Si and a molecular weight of 370.57 g/mol. Its IUPAC name is 6-diphenylsilyloxy-7,7-dimethyloct-1-ene-4,5-diol.
| Compound Name | 6-diphenylsilyloxy-7,7-dimethyloct-1-ene-4,5-diol |
|---|---|
| PubChem CID | 173316919 |
| Molecular Formula | C22H30O3Si |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 6-diphenylsilyloxy-7,7-dimethyloct-1-ene-4,5-diol |
| SMILES | C=CCC(O)C(O)C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C22H30O3Si/c1-5-12-19(23)20(24)21(22(2,3)4)25-26(17-13-8-6-9-14-17)18-15-10-7-11-16-18/h5-11,13-16,19-21,23-24,26H,1,12H2,2-4H3 |
| InChIKey | NTFITGLDMVKWPM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|