About [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate
[(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate (PubChem CID 162413063) has the molecular formula C19H27NO3
and a molecular weight of 317.43 g/mol. Its IUPAC name is [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate.
Molecular Properties
| Compound Name | [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate |
| PubChem CID | 162413063 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate |
| SMILES | C=CC[C@H](C(=O)N(C)c1ccccc1)[C@H](OC(C)=O)C(C)(C)C |
| InChI | InChI=1S/C19H27NO3/c1-7-11-16(17(19(3,4)5)23-14(2)21)18(22)20(6)15-12-9-8-10-13-15/h7-10,12-13,16-17H,1,11H2,2-6H3/t16-,17-/m0/s1 |
| InChIKey | FLLDHFUVIXLASY-IRXDYDNUSA-N |
| XLogP | 3.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate?
The IUPAC name of [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate (CID 162413063) is [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate.
What is the SMILES notation for [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate?
The canonical SMILES for [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate is C=CC[C@H](C(=O)N(C)c1ccccc1)[C@H](OC(C)=O)C(C)(C)C.
What is the InChIKey of [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate?
The InChIKey is FLLDHFUVIXLASY-IRXDYDNUSA-N. The full InChI is InChI=1S/C19H27NO3/c1-7-11-16(17(19(3,4)5)23-14(2)21)18(22)20(6)15-12-9-8-10-13-15/h7-10,12-13,16-17H,1,11H2,2-6H3/t16-,17-/m0/s1.
What are the key properties of [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate?
[(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate has a molecular weight of 317.43 g/mol, XLogP of 3.82, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4S)-2,2-dimethyl-4-[methyl(phenyl)carbamoyl]hept-6-en-3-yl] acetate is sourced from PubChem (CID 162413063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).