C25H42AlNOSi — CID 173186725
(4S)-3-diphenylsilyloxy-2,2,6-trimethylheptan-4-amine;trimethylalumane (PubChem CID 173186725) has the molecular formula C25H42AlNOSi and a molecular weight of 427.69 g/mol. Its IUPAC name is (4S)-3-diphenylsilyloxy-2,2,6-trimethylheptan-4-amine;trimethylalumane.
| Compound Name | (4S)-3-diphenylsilyloxy-2,2,6-trimethylheptan-4-amine;trimethylalumane |
|---|---|
| PubChem CID | 173186725 |
| Molecular Formula | C25H42AlNOSi |
| Molecular Weight | 427.69 g/mol |
| Exact Mass | 427.29 |
| IUPAC Name | (4S)-3-diphenylsilyloxy-2,2,6-trimethylheptan-4-amine;trimethylalumane |
| SMILES | CC(C)C[C@H](N)C(O[SiH](c1ccccc1)c1ccccc1)C(C)(C)C.C[Al](C)C |
| InChI | InChI=1S/C22H33NOSi.3CH3.Al/c1-17(2)16-20(23)21(22(3,4)5)24-25(18-12-8-6-9-13-18)19-14-10-7-11-15-19;;;;/h6-15,17,20-21,25H,16,23H2,1-5H3;3*1H3;/t20-,21?;;;;/m0..../s1 |
| InChIKey | IATCAFHTZSEPHJ-QGYRAXHHSA-N |
| XLogP | 4.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|