C17H28O2 — CID 155094998
2-(2,2-dimethylhexan-3-ylperoxy)propan-2-ylbenzene (PubChem CID 155094998) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is 2-(2,2-dimethylhexan-3-ylperoxy)propan-2-ylbenzene.
| Compound Name | 2-(2,2-dimethylhexan-3-ylperoxy)propan-2-ylbenzene |
|---|---|
| PubChem CID | 155094998 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | 2-(2,2-dimethylhexan-3-ylperoxy)propan-2-ylbenzene |
| SMILES | CCCC(OOC(C)(C)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H28O2/c1-7-11-15(16(2,3)4)18-19-17(5,6)14-12-9-8-10-13-14/h8-10,12-13,15H,7,11H2,1-6H3 |
| InChIKey | UIOHVCAULVTDTQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|