C30H42OPSi+ — CID 173329265
(6-dimethylsilyloxy-7,7-dimethyloctyl)-triphenylphosphanium (PubChem CID 173329265) has the molecular formula C30H42OPSi+ and a molecular weight of 477.73 g/mol. Its IUPAC name is (6-dimethylsilyloxy-7,7-dimethyloctyl)-triphenylphosphanium.
| Compound Name | (6-dimethylsilyloxy-7,7-dimethyloctyl)-triphenylphosphanium |
|---|---|
| PubChem CID | 173329265 |
| Molecular Formula | C30H42OPSi+ |
| Molecular Weight | 477.73 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | (6-dimethylsilyloxy-7,7-dimethyloctyl)-triphenylphosphanium |
| SMILES | C[SiH](C)OC(CCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H42OPSi/c1-30(2,3)29(31-33(4)5)24-16-9-17-25-32(26-18-10-6-11-19-26,27-20-12-7-13-21-27)28-22-14-8-15-23-28/h6-8,10-15,18-23,29,33H,9,16-17,24-25H2,1-5H3/q+1 |
| InChIKey | ZDGBPCWWUGNCEG-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.73 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|