C9H20N2 — CID 22415223
4-propan-2-ylcyclohexane-1,2-diamine (PubChem CID 22415223) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 4-propan-2-ylcyclohexane-1,2-diamine.
| Compound Name | 4-propan-2-ylcyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 22415223 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 4-propan-2-ylcyclohexane-1,2-diamine |
| SMILES | CC(C)C1CCC(N)C(N)C1 |
| InChI | InChI=1S/C9H20N2/c1-6(2)7-3-4-8(10)9(11)5-7/h6-9H,3-5,10-11H2,1-2H3 |
| InChIKey | AYNJLCBPBQGVSC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |