C17H23ClN2O2 — CID 134229326
tert-butyl (3R)-5-(3-amino-4-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate (PubChem CID 134229326) has the molecular formula C17H23ClN2O2 and a molecular weight of 322.84 g/mol. Its IUPAC name is tert-butyl (3R)-5-(3-amino-4-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl (3R)-5-(3-amino-4-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 134229326 |
| Molecular Formula | C17H23ClN2O2 |
| Molecular Weight | 322.84 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | tert-butyl (3R)-5-(3-amino-4-chlorophenyl)-3-methyl-3,4-dihydro-2H-pyridine-1-carboxylate |
| SMILES | C[C@@H]1CC(c2ccc(Cl)c(N)c2)=CN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C17H23ClN2O2/c1-11-7-13(12-5-6-14(18)15(19)8-12)10-20(9-11)16(21)22-17(2,3)4/h5-6,8,10-11H,7,9,19H2,1-4H3/t11-/m1/s1 |
| InChIKey | CUUFFWUFTCKHPT-LLVKDONJSA-N |
| XLogP | 4.54 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|