C17H22ClNO2 — CID 89460146
tert-butyl (E)-3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoate (PubChem CID 89460146) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is tert-butyl (E)-3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoate.
| Compound Name | tert-butyl (E)-3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoate |
|---|---|
| PubChem CID | 89460146 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | tert-butyl (E)-3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoate |
| SMILES | CC(C)(C)OC(=O)/C=C(\CC1CC1)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C17H22ClNO2/c1-17(2,3)21-16(20)10-13(8-11-4-5-11)12-6-7-14(18)15(19)9-12/h6-7,9-11H,4-5,8,19H2,1-3H3/b13-10+ |
| InChIKey | AXUPYVKNSVJAMF-JLHYYAGUSA-N |
| XLogP | 4.45 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|