C13H14ClNO2 — CID 123511490
3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoic acid (PubChem CID 123511490) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is 3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoic acid.
| Compound Name | 3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoic acid |
|---|---|
| PubChem CID | 123511490 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(3-amino-4-chlorophenyl)-4-cyclopropylbut-2-enoic acid |
| SMILES | Nc1cc(C(=CC(=O)O)CC2CC2)ccc1Cl |
| InChI | InChI=1S/C13H14ClNO2/c14-11-4-3-9(6-12(11)15)10(7-13(16)17)5-8-1-2-8/h3-4,6-8H,1-2,5,15H2,(H,16,17) |
| InChIKey | XNFUVXSFTIATBH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|