C15H19ClN2O4 — CID 57423002
tert-butyl 3-(3-carbamoyl-4-chlorophenoxy)azetidine-1-carboxylate (PubChem CID 57423002) has the molecular formula C15H19ClN2O4 and a molecular weight of 326.78 g/mol. Its IUPAC name is tert-butyl 3-(3-carbamoyl-4-chlorophenoxy)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3-carbamoyl-4-chlorophenoxy)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 57423002 |
| Molecular Formula | C15H19ClN2O4 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | tert-butyl 3-(3-carbamoyl-4-chlorophenoxy)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc(Cl)c(C(N)=O)c2)C1 |
| InChI | InChI=1S/C15H19ClN2O4/c1-15(2,3)22-14(20)18-7-10(8-18)21-9-4-5-12(16)11(6-9)13(17)19/h4-6,10H,7-8H2,1-3H3,(H2,17,19) |
| InChIKey | PSNJIRJCUVJFDC-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |