C21H23NO3 — CID 163184937
tert-butyl 3-(9H-fluoren-2-yloxy)azetidine-1-carboxylate (PubChem CID 163184937) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is tert-butyl 3-(9H-fluoren-2-yloxy)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(9H-fluoren-2-yloxy)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163184937 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | tert-butyl 3-(9H-fluoren-2-yloxy)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc3c(c2)Cc2ccccc2-3)C1 |
| InChI | InChI=1S/C21H23NO3/c1-21(2,3)25-20(23)22-12-17(13-22)24-16-8-9-19-15(11-16)10-14-6-4-5-7-18(14)19/h4-9,11,17H,10,12-13H2,1-3H3 |
| InChIKey | YICKJWJIVPECOL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |