C21H25N3O7 — CID 154670537
tert-butyl 3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]oxy]azetidine-1-carboxylate (PubChem CID 154670537) has the molecular formula C21H25N3O7 and a molecular weight of 431.45 g/mol. Its IUPAC name is tert-butyl 3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]oxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]oxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 154670537 |
| Molecular Formula | C21H25N3O7 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | tert-butyl 3-[[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]oxy]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3O)C1 |
| InChI | InChI=1S/C21H25N3O7/c1-21(2,3)31-20(29)23-9-12(10-23)30-11-4-5-13-14(8-11)19(28)24(18(13)27)15-6-7-16(25)22-17(15)26/h4-5,8,12,15,18,27H,6-7,9-10H2,1-3H3,(H,22,25,26) |
| InChIKey | DPBYQBFQGIWFKC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|