C23H30N2O6 — CID 175565572
[1-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] hexaneperoxoate (PubChem CID 175565572) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is [1-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] hexaneperoxoate.
| Compound Name | [1-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] hexaneperoxoate |
|---|---|
| PubChem CID | 175565572 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | [1-tert-butyl-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl] hexaneperoxoate |
| SMILES | CCCCCC(=O)OOc1ccc2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2C(C)(C)C |
| InChI | InChI=1S/C23H30N2O6/c1-5-6-7-8-19(27)31-30-14-9-10-15-16(13-14)22(29)25(20(15)23(2,3)4)17-11-12-18(26)24-21(17)28/h9-10,13,17,20H,5-8,11-12H2,1-4H3,(H,24,26,28) |
| InChIKey | OFZSHQKSFGHGMK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|