C18H20N2O4 — CID 155036962
3-(1-hydroxy-3-oxo-6-pent-1-en-2-yl-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 155036962) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-(1-hydroxy-3-oxo-6-pent-1-en-2-yl-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(1-hydroxy-3-oxo-6-pent-1-en-2-yl-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 155036962 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 3-(1-hydroxy-3-oxo-6-pent-1-en-2-yl-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | C=C(CCC)c1ccc2c(c1)C(O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H20N2O4/c1-3-4-10(2)11-5-6-12-13(9-11)18(24)20(17(12)23)14-7-8-15(21)19-16(14)22/h5-6,9,14,18,24H,2-4,7-8H2,1H3,(H,19,21,22) |
| InChIKey | DSCCIEOGCZKHNC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|