C26H28N4O5 — CID 155769118
benzyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxo-3H-isoindol-5-yl]piperazine-1-carboxylate (PubChem CID 155769118) has the molecular formula C26H28N4O5 and a molecular weight of 476.53 g/mol. Its IUPAC name is benzyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxo-3H-isoindol-5-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxo-3H-isoindol-5-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 155769118 |
| Molecular Formula | C26H28N4O5 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | benzyl 4-[2-(2,6-dioxopiperidin-3-yl)-3-methyl-1-oxo-3H-isoindol-5-yl]piperazine-1-carboxylate |
| SMILES | CC1c2cc(N3CCN(C(=O)OCc4ccccc4)CC3)ccc2C(=O)N1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C26H28N4O5/c1-17-21-15-19(7-8-20(21)25(33)30(17)22-9-10-23(31)27-24(22)32)28-11-13-29(14-12-28)26(34)35-16-18-5-3-2-4-6-18/h2-8,15,17,22H,9-14,16H2,1H3,(H,27,31,32) |
| InChIKey | CYLSJGYVVVOJDU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|