C30H33N5O6 — CID 166545635
benzyl 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-4-yl]piperazine-1-carboxylate (PubChem CID 166545635) has the molecular formula C30H33N5O6 and a molecular weight of 559.62 g/mol. Its IUPAC name is benzyl 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-4-yl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166545635 |
| Molecular Formula | C30H33N5O6 |
| Molecular Weight | 559.62 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | benzyl 4-[1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]piperidin-4-yl]piperazine-1-carboxylate |
| SMILES | O=C1CCC(N2C(=O)c3cccc(N4CCC(N5CCN(C(=O)OCc6ccccc6)CC5)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H33N5O6/c36-25-10-9-24(27(37)31-25)35-28(38)22-7-4-8-23(26(22)29(35)39)33-13-11-21(12-14-33)32-15-17-34(18-16-32)30(40)41-19-20-5-2-1-3-6-20/h1-8,21,24H,9-19H2,(H,31,36,37) |
| InChIKey | LQPNJVPJXIADLD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 119.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.62 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|