C32H39N5O6 — CID 165153488
benzyl 4-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]ethyl]piperazine-1-carboxylate (PubChem CID 165153488) has the molecular formula C32H39N5O6 and a molecular weight of 589.69 g/mol. Its IUPAC name is benzyl 4-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]ethyl]piperazine-1-carboxylate.
| Compound Name | benzyl 4-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]ethyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 165153488 |
| Molecular Formula | C32H39N5O6 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.29 |
| IUPAC Name | benzyl 4-[2-[1-[2-(2,6-dioxopiperidin-3-yl)-1-hydroxy-3-oxo-1H-isoindol-5-yl]piperidin-4-yl]ethyl]piperazine-1-carboxylate |
| SMILES | O=C1CCC(N2C(=O)c3cc(N4CCC(CCN5CCN(C(=O)OCc6ccccc6)CC5)CC4)ccc3C2O)C(=O)N1 |
| InChI | InChI=1S/C32H39N5O6/c38-28-9-8-27(29(39)33-28)37-30(40)25-7-6-24(20-26(25)31(37)41)35-14-11-22(12-15-35)10-13-34-16-18-36(19-17-34)32(42)43-21-23-4-2-1-3-5-23/h1-7,20,22,27,30,40H,8-19,21H2,(H,33,38,39) |
| InChIKey | JQZLUNMNTKGJCV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|