C45H47N5O6 — CID 155172491
2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[4-(7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl)phenyl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 155172491) has the molecular formula C45H47N5O6 and a molecular weight of 753.90 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[4-(7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl)phenyl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[4-(7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl)phenyl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 155172491 |
| Molecular Formula | C45H47N5O6 |
| Molecular Weight | 753.90 g/mol |
| Exact Mass | 753.35 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-[4-[2-[1-[4-(7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl)phenyl]piperidin-4-yl]ethyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCN(CCC5CCN(c6ccc(C7c8ccc(O)cc8OCC7c7ccccc7)cc6)CC5)CC4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C45H47N5O6/c51-34-11-13-36-40(27-34)56-28-38(30-4-2-1-3-5-30)42(36)31-6-8-32(9-7-31)48-20-17-29(18-21-48)16-19-47-22-24-49(25-23-47)33-10-12-35-37(26-33)45(55)50(44(35)54)39-14-15-41(52)46-43(39)53/h1-13,26-27,29,38-39,42,51H,14-25,28H2,(H,46,52,53) |
| InChIKey | KBLZHKYBEZDNQH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 122.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.90 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|