C23H30N2O5 — CID 167015017
3-[6-(8,8-dihydroxyoct-1-en-2-yl)-4-methyl-2-oxo-3,4-dihydroquinolin-1-yl]piperidine-2,6-dione (PubChem CID 167015017) has the molecular formula C23H30N2O5 and a molecular weight of 414.50 g/mol. Its IUPAC name is 3-[6-(8,8-dihydroxyoct-1-en-2-yl)-4-methyl-2-oxo-3,4-dihydroquinolin-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-(8,8-dihydroxyoct-1-en-2-yl)-4-methyl-2-oxo-3,4-dihydroquinolin-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167015017 |
| Molecular Formula | C23H30N2O5 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 3-[6-(8,8-dihydroxyoct-1-en-2-yl)-4-methyl-2-oxo-3,4-dihydroquinolin-1-yl]piperidine-2,6-dione |
| SMILES | C=C(CCCCCC(O)O)c1ccc2c(c1)C(C)CC(=O)N2C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H30N2O5/c1-14(6-4-3-5-7-22(28)29)16-8-9-18-17(13-16)15(2)12-21(27)25(18)19-10-11-20(26)24-23(19)30/h8-9,13,15,19,22,28-29H,1,3-7,10-12H2,2H3,(H,24,26,30) |
| InChIKey | YFFULFNTEGTUBP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|