C31H33NO3 — CID 129121980
tert-butyl 3-[4-(6-methyl-2-phenyl-3,4-dihydronaphthalen-1-yl)phenoxy]azetidine-1-carboxylate (PubChem CID 129121980) has the molecular formula C31H33NO3 and a molecular weight of 467.61 g/mol. Its IUPAC name is tert-butyl 3-[4-(6-methyl-2-phenyl-3,4-dihydronaphthalen-1-yl)phenoxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(6-methyl-2-phenyl-3,4-dihydronaphthalen-1-yl)phenoxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 129121980 |
| Molecular Formula | C31H33NO3 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | tert-butyl 3-[4-(6-methyl-2-phenyl-3,4-dihydronaphthalen-1-yl)phenoxy]azetidine-1-carboxylate |
| SMILES | Cc1ccc2c(c1)CCC(c1ccccc1)=C2c1ccc(OC2CN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C31H33NO3/c1-21-10-16-28-24(18-21)13-17-27(22-8-6-5-7-9-22)29(28)23-11-14-25(15-12-23)34-26-19-32(20-26)30(33)35-31(2,3)4/h5-12,14-16,18,26H,13,17,19-20H2,1-4H3 |
| InChIKey | IABJJQRWLPFHLZ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|