C27H28N2O3 — CID 118903430
tert-butyl 3-[4-(benzhydrylideneamino)phenoxy]azetidine-1-carboxylate (PubChem CID 118903430) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is tert-butyl 3-[4-(benzhydrylideneamino)phenoxy]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(benzhydrylideneamino)phenoxy]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 118903430 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | tert-butyl 3-[4-(benzhydrylideneamino)phenoxy]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2ccc(N=C(c3ccccc3)c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C27H28N2O3/c1-27(2,3)32-26(30)29-18-24(19-29)31-23-16-14-22(15-17-23)28-25(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-17,24H,18-19H2,1-3H3 |
| InChIKey | CDXGRQHPVHBLEE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|